C21H24N2O2S2 — CID 96519515
2-[(4aR,7aS)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl]-2-oxo-N-[2-(thiophen-3-ylmethylsulfanyl)phenyl]acetamide (PubChem CID 96519515) has the molecular formula C21H24N2O2S2 and a molecular weight of 400.57 g/mol. Its IUPAC name is 2-[(4aR,7aS)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl]-2-oxo-N-[2-(thiophen-3-ylmethylsulfanyl)phenyl]acetamide.
| Compound Name | 2-[(4aR,7aS)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl]-2-oxo-N-[2-(thiophen-3-ylmethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 96519515 |
| Molecular Formula | C21H24N2O2S2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 2-[(4aR,7aS)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl]-2-oxo-N-[2-(thiophen-3-ylmethylsulfanyl)phenyl]acetamide |
| SMILES | O=C(Nc1ccccc1SCc1ccsc1)C(=O)N1CCC[C@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C21H24N2O2S2/c24-20(21(25)23-11-4-6-16-5-3-8-18(16)23)22-17-7-1-2-9-19(17)27-14-15-10-12-26-13-15/h1-2,7,9-10,12-13,16,18H,3-6,8,11,14H2,(H,22,24)/t16-,18+/m1/s1 |
| InChIKey | IQKQPURULIHEKS-AEFFLSMTSA-N |
| XLogP | 4.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|