C22H29N3O3S3 — CID 24658604
[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-[2-(thiophen-3-ylmethylsulfanyl)phenyl]methanone (PubChem CID 24658604) has the molecular formula C22H29N3O3S3 and a molecular weight of 479.69 g/mol. Its IUPAC name is [4-(azepan-1-ylsulfonyl)piperazin-1-yl]-[2-(thiophen-3-ylmethylsulfanyl)phenyl]methanone.
| Compound Name | [4-(azepan-1-ylsulfonyl)piperazin-1-yl]-[2-(thiophen-3-ylmethylsulfanyl)phenyl]methanone |
|---|---|
| PubChem CID | 24658604 |
| Molecular Formula | C22H29N3O3S3 |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | [4-(azepan-1-ylsulfonyl)piperazin-1-yl]-[2-(thiophen-3-ylmethylsulfanyl)phenyl]methanone |
| SMILES | O=C(c1ccccc1SCc1ccsc1)N1CCN(S(=O)(=O)N2CCCCCC2)CC1 |
| InChI | InChI=1S/C22H29N3O3S3/c26-22(20-7-3-4-8-21(20)30-18-19-9-16-29-17-19)23-12-14-25(15-13-23)31(27,28)24-10-5-1-2-6-11-24/h3-4,7-9,16-17H,1-2,5-6,10-15,18H2 |
| InChIKey | UCOBSTJRQZPKLQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |