C24H22N4O3S2 — CID 16960648
4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[2-(thiophen-3-ylmethylsulfanyl)phenyl]benzamide (PubChem CID 16960648) has the molecular formula C24H22N4O3S2 and a molecular weight of 478.60 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[2-(thiophen-3-ylmethylsulfanyl)phenyl]benzamide.
| Compound Name | 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[2-(thiophen-3-ylmethylsulfanyl)phenyl]benzamide |
|---|---|
| PubChem CID | 16960648 |
| Molecular Formula | C24H22N4O3S2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[2-(thiophen-3-ylmethylsulfanyl)phenyl]benzamide |
| SMILES | Cc1nn(Cc2ccc(C(=O)Nc3ccccc3SCc3ccsc3)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C24H22N4O3S2/c1-16-23(28(30)31)17(2)27(26-16)13-18-7-9-20(10-8-18)24(29)25-21-5-3-4-6-22(21)33-15-19-11-12-32-14-19/h3-12,14H,13,15H2,1-2H3,(H,25,29) |
| InChIKey | PBYSVRVEOOBBRD-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|