C21H17ClFNOS — CID 100574546
N-[2-[(4-chlorophenyl)methylsulfanyl]phenyl]-2-(4-fluorophenyl)acetamide (PubChem CID 100574546) has the molecular formula C21H17ClFNOS and a molecular weight of 385.89 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)methylsulfanyl]phenyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[2-[(4-chlorophenyl)methylsulfanyl]phenyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 100574546 |
| Molecular Formula | C21H17ClFNOS |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | N-[2-[(4-chlorophenyl)methylsulfanyl]phenyl]-2-(4-fluorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(F)cc1)Nc1ccccc1SCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H17ClFNOS/c22-17-9-5-16(6-10-17)14-26-20-4-2-1-3-19(20)24-21(25)13-15-7-11-18(23)12-8-15/h1-12H,13-14H2,(H,24,25) |
| InChIKey | NQSNOQRPHUTYPV-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |