C17H18FNOS2 — CID 92684443
N-(2-ethylsulfanylphenyl)-2-[(4-fluorophenyl)methylsulfanyl]acetamide (PubChem CID 92684443) has the molecular formula C17H18FNOS2 and a molecular weight of 335.47 g/mol. Its IUPAC name is N-(2-ethylsulfanylphenyl)-2-[(4-fluorophenyl)methylsulfanyl]acetamide.
| Compound Name | N-(2-ethylsulfanylphenyl)-2-[(4-fluorophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 92684443 |
| Molecular Formula | C17H18FNOS2 |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | N-(2-ethylsulfanylphenyl)-2-[(4-fluorophenyl)methylsulfanyl]acetamide |
| SMILES | CCSc1ccccc1NC(=O)CSCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H18FNOS2/c1-2-22-16-6-4-3-5-15(16)19-17(20)12-21-11-13-7-9-14(18)10-8-13/h3-10H,2,11-12H2,1H3,(H,19,20) |
| InChIKey | ZDUGNBYNWVCYTF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |