C16H17ClN2O3 — CID 28867944
N-(5-amino-2-chlorophenyl)-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 28867944) has the molecular formula C16H17ClN2O3 and a molecular weight of 320.78 g/mol. Its IUPAC name is N-(5-amino-2-chlorophenyl)-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-(5-amino-2-chlorophenyl)-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 28867944 |
| Molecular Formula | C16H17ClN2O3 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | N-(5-amino-2-chlorophenyl)-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)Nc2cc(N)ccc2Cl)cc1OC |
| InChI | InChI=1S/C16H17ClN2O3/c1-21-14-6-3-10(7-15(14)22-2)8-16(20)19-13-9-11(18)4-5-12(13)17/h3-7,9H,8,18H2,1-2H3,(H,19,20) |
| InChIKey | XMCQUYUCRWIUQE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|