C13H15FN2O2 — CID 114249895
3-fluoro-4-(4-hydroxy-4-methylpiperidin-3-yl)oxybenzonitrile (PubChem CID 114249895) has the molecular formula C13H15FN2O2 and a molecular weight of 250.27 g/mol. Its IUPAC name is 3-fluoro-4-(4-hydroxy-4-methylpiperidin-3-yl)oxybenzonitrile.
| Compound Name | 3-fluoro-4-(4-hydroxy-4-methylpiperidin-3-yl)oxybenzonitrile |
|---|---|
| PubChem CID | 114249895 |
| Molecular Formula | C13H15FN2O2 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 3-fluoro-4-(4-hydroxy-4-methylpiperidin-3-yl)oxybenzonitrile |
| SMILES | CC1(O)CCNCC1Oc1ccc(C#N)cc1F |
| InChI | InChI=1S/C13H15FN2O2/c1-13(17)4-5-16-8-12(13)18-11-3-2-9(7-15)6-10(11)14/h2-3,6,12,16-17H,4-5,8H2,1H3 |
| InChIKey | LLGNMIOUFXRZEM-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |