C7H12N2O — CID 130972078
(3S,4R)-4-hydroxy-4-methylpiperidine-3-carbonitrile (PubChem CID 130972078) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is (3S,4R)-4-hydroxy-4-methylpiperidine-3-carbonitrile.
| Compound Name | (3S,4R)-4-hydroxy-4-methylpiperidine-3-carbonitrile |
|---|---|
| PubChem CID | 130972078 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | (3S,4R)-4-hydroxy-4-methylpiperidine-3-carbonitrile |
| SMILES | C[C@@]1(O)CCNC[C@H]1C#N |
| InChI | InChI=1S/C7H12N2O/c1-7(10)2-3-9-5-6(7)4-8/h6,9-10H,2-3,5H2,1H3/t6-,7-/m1/s1 |
| InChIKey | FGHJUQOEHVZZQY-RNFRBKRXSA-N |
| XLogP | -0.13 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |