About 2-[benzyl-[(1R,2R)-2-trityloxycyclopentyl]amino]ethanol
2-[benzyl-[(1R,2R)-2-trityloxycyclopentyl]amino]ethanol (PubChem CID 102055377) has the molecular formula C33H35NO2
and a molecular weight of 477.65 g/mol. Its IUPAC name is 2-[benzyl-[(1R,2R)-2-trityloxycyclopentyl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[benzyl-[(1R,2R)-2-trityloxycyclopentyl]amino]ethanol |
| PubChem CID | 102055377 |
| Molecular Formula | C33H35NO2 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | 2-[benzyl-[(1R,2R)-2-trityloxycyclopentyl]amino]ethanol |
| SMILES | OCCN(Cc1ccccc1)[C@@H]1CCC[C@H]1OC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H35NO2/c35-25-24-34(26-27-14-5-1-6-15-27)31-22-13-23-32(31)36-33(28-16-7-2-8-17-28,29-18-9-3-10-19-29)30-20-11-4-12-21-30/h1-12,14-21,31-32,35H,13,22-26H2/t31-,32-/m1/s1 |
| InChIKey | QRHRCEWAAPIQNT-ROJLCIKYSA-N |
| XLogP | 6.41 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 2-[benzyl-[(1R,2R)-2-trityloxycyclopentyl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[benzyl-[(1R,2R)-2-trityloxycyclopentyl]amino]ethanol?
The IUPAC name of 2-[benzyl-[(1R,2R)-2-trityloxycyclopentyl]amino]ethanol (CID 102055377) is 2-[benzyl-[(1R,2R)-2-trityloxycyclopentyl]amino]ethanol.
What is the SMILES notation for 2-[benzyl-[(1R,2R)-2-trityloxycyclopentyl]amino]ethanol?
The canonical SMILES for 2-[benzyl-[(1R,2R)-2-trityloxycyclopentyl]amino]ethanol is OCCN(Cc1ccccc1)[C@@H]1CCC[C@H]1OC(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-[benzyl-[(1R,2R)-2-trityloxycyclopentyl]amino]ethanol?
The InChIKey is QRHRCEWAAPIQNT-ROJLCIKYSA-N. The full InChI is InChI=1S/C33H35NO2/c35-25-24-34(26-27-14-5-1-6-15-27)31-22-13-23-32(31)36-33(28-16-7-2-8-17-28,29-18-9-3-10-19-29)30-20-11-4-12-21-30/h1-12,14-21,31-32,35H,13,22-26H2/t31-,32-/m1/s1.
What are the key properties of 2-[benzyl-[(1R,2R)-2-trityloxycyclopentyl]amino]ethanol?
2-[benzyl-[(1R,2R)-2-trityloxycyclopentyl]amino]ethanol has a molecular weight of 477.65 g/mol, XLogP of 6.41, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[benzyl-[(1R,2R)-2-trityloxycyclopentyl]amino]ethanol is sourced from PubChem (CID 102055377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).