C16H22N2O5S — CID 102565917
N-[2-[(4-hydroxy-1,1-dioxothiolan-3-yl)-propanoylamino]ethyl]benzamide (PubChem CID 102565917) has the molecular formula C16H22N2O5S and a molecular weight of 354.43 g/mol. Its IUPAC name is N-[2-[(4-hydroxy-1,1-dioxothiolan-3-yl)-propanoylamino]ethyl]benzamide.
| Compound Name | N-[2-[(4-hydroxy-1,1-dioxothiolan-3-yl)-propanoylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 102565917 |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-[2-[(4-hydroxy-1,1-dioxothiolan-3-yl)-propanoylamino]ethyl]benzamide |
| SMILES | CCC(=O)N(CCNC(=O)c1ccccc1)C1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C16H22N2O5S/c1-2-15(20)18(13-10-24(22,23)11-14(13)19)9-8-17-16(21)12-6-4-3-5-7-12/h3-7,13-14,19H,2,8-11H2,1H3,(H,17,21) |
| InChIKey | LLBQFZSMVPTOHE-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |