C16H28CdN2O8S6 — CID 21206191
cadmium(2+);bis(N-(2,3-dihydroxypropyl)-N-(1,1-dioxothiolan-3-yl)carbamodithioate) (PubChem CID 21206191) has the molecular formula C16H28CdN2O8S6 and a molecular weight of 681.22 g/mol. Its IUPAC name is cadmium(2+);bis(N-(2,3-dihydroxypropyl)-N-(1,1-dioxothiolan-3-yl)carbamodithioate).
| Compound Name | cadmium(2+);bis(N-(2,3-dihydroxypropyl)-N-(1,1-dioxothiolan-3-yl)carbamodithioate) |
|---|---|
| PubChem CID | 21206191 |
| Molecular Formula | C16H28CdN2O8S6 |
| Molecular Weight | 681.22 g/mol |
| Exact Mass | 681.92 |
| IUPAC Name | cadmium(2+);bis(N-(2,3-dihydroxypropyl)-N-(1,1-dioxothiolan-3-yl)carbamodithioate) |
| SMILES | O=S1(=O)CCC(N(CC(O)CO)C(=S)[S-])C1.O=S1(=O)CCC(N(CC(O)CO)C(=S)[S-])C1.[Cd+2] |
| InChI | InChI=1S/2C8H15NO4S3.Cd/c2*10-4-7(11)3-9(8(14)15)6-1-2-16(12,13)5-6;/h2*6-7,10-11H,1-5H2,(H,14,15);/q;;+2/p-2 |
| InChIKey | CKVGTVOEIQZTFD-UHFFFAOYSA-L |
| XLogP | -2.68 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.22 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|