C10H19NO4S2 — CID 43392466
N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-(2-hydroxyethylsulfanyl)acetamide (PubChem CID 43392466) has the molecular formula C10H19NO4S2 and a molecular weight of 281.40 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-(2-hydroxyethylsulfanyl)acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-(2-hydroxyethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 43392466 |
| Molecular Formula | C10H19NO4S2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-(2-hydroxyethylsulfanyl)acetamide |
| SMILES | CCN(C(=O)CSCCO)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H19NO4S2/c1-2-11(10(13)7-16-5-4-12)9-3-6-17(14,15)8-9/h9,12H,2-8H2,1H3 |
| InChIKey | WGPOVZPFFBDSQB-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|