C20H33NO3S2 — CID 78786540
2-[2-(1-adamantyl)ethylsulfanyl]-N-(1,1-dioxothiolan-3-yl)-N-ethylacetamide (PubChem CID 78786540) has the molecular formula C20H33NO3S2 and a molecular weight of 399.62 g/mol. Its IUPAC name is 2-[2-(1-adamantyl)ethylsulfanyl]-N-(1,1-dioxothiolan-3-yl)-N-ethylacetamide.
| Compound Name | 2-[2-(1-adamantyl)ethylsulfanyl]-N-(1,1-dioxothiolan-3-yl)-N-ethylacetamide |
|---|---|
| PubChem CID | 78786540 |
| Molecular Formula | C20H33NO3S2 |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 2-[2-(1-adamantyl)ethylsulfanyl]-N-(1,1-dioxothiolan-3-yl)-N-ethylacetamide |
| SMILES | CCN(C(=O)CSCCC12CC3CC(CC(C3)C1)C2)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H33NO3S2/c1-2-21(18-3-6-26(23,24)14-18)19(22)13-25-5-4-20-10-15-7-16(11-20)9-17(8-15)12-20/h15-18H,2-14H2,1H3 |
| InChIKey | DBAZNZVXKRLKKD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|