C15H22N2O5S — CID 164663520
2-[2,3-dihydroxypropyl-(1,1-dioxothiolan-3-yl)amino]-N-phenylacetamide (PubChem CID 164663520) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-[2,3-dihydroxypropyl-(1,1-dioxothiolan-3-yl)amino]-N-phenylacetamide.
| Compound Name | 2-[2,3-dihydroxypropyl-(1,1-dioxothiolan-3-yl)amino]-N-phenylacetamide |
|---|---|
| PubChem CID | 164663520 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-[2,3-dihydroxypropyl-(1,1-dioxothiolan-3-yl)amino]-N-phenylacetamide |
| SMILES | O=C(CN(CC(O)CO)C1CCS(=O)(=O)C1)Nc1ccccc1 |
| InChI | InChI=1S/C15H22N2O5S/c18-10-14(19)8-17(13-6-7-23(21,22)11-13)9-15(20)16-12-4-2-1-3-5-12/h1-5,13-14,18-19H,6-11H2,(H,16,20) |
| InChIKey | BJHQLPFNTMEBKC-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |