C15H17IN2O3S — CID 56540953
2-[(1,1-dioxothiolan-3-yl)-prop-2-ynylamino]-N-(2-iodophenyl)acetamide (PubChem CID 56540953) has the molecular formula C15H17IN2O3S and a molecular weight of 432.28 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-prop-2-ynylamino]-N-(2-iodophenyl)acetamide.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)-prop-2-ynylamino]-N-(2-iodophenyl)acetamide |
|---|---|
| PubChem CID | 56540953 |
| Molecular Formula | C15H17IN2O3S |
| Molecular Weight | 432.28 g/mol |
| Exact Mass | 432.00 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)-prop-2-ynylamino]-N-(2-iodophenyl)acetamide |
| SMILES | C#CCN(CC(=O)Nc1ccccc1I)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H17IN2O3S/c1-2-8-18(12-7-9-22(20,21)11-12)10-15(19)17-14-6-4-3-5-13(14)16/h1,3-6,12H,7-11H2,(H,17,19) |
| InChIKey | MKFDPPPYQVDMRQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|