C19H21FN4O3S — CID 56541078
2-[(1,1-dioxothiolan-3-yl)-prop-2-ynylamino]-N-[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]acetamide (PubChem CID 56541078) has the molecular formula C19H21FN4O3S and a molecular weight of 404.47 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-prop-2-ynylamino]-N-[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]acetamide.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)-prop-2-ynylamino]-N-[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]acetamide |
|---|---|
| PubChem CID | 56541078 |
| Molecular Formula | C19H21FN4O3S |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)-prop-2-ynylamino]-N-[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]acetamide |
| SMILES | C#CCN(CC(=O)Nc1cc(C)nn1-c1ccc(F)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H21FN4O3S/c1-3-9-23(17-8-10-28(26,27)13-17)12-19(25)21-18-11-14(2)22-24(18)16-6-4-15(20)5-7-16/h1,4-7,11,17H,8-10,12-13H2,2H3,(H,21,25) |
| InChIKey | CPEAVSQBYKPCIT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|