C15H18FNO3S — CID 111110017
2-[(1,1-dioxothiolan-3-yl)-prop-2-ynylamino]-1-(4-fluorophenyl)ethanol (PubChem CID 111110017) has the molecular formula C15H18FNO3S and a molecular weight of 311.38 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-prop-2-ynylamino]-1-(4-fluorophenyl)ethanol.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)-prop-2-ynylamino]-1-(4-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 111110017 |
| Molecular Formula | C15H18FNO3S |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)-prop-2-ynylamino]-1-(4-fluorophenyl)ethanol |
| SMILES | C#CCN(CC(O)c1ccc(F)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H18FNO3S/c1-2-8-17(14-7-9-21(19,20)11-14)10-15(18)12-3-5-13(16)6-4-12/h1,3-6,14-15,18H,7-11H2 |
| InChIKey | VJMORFOCXCFYDA-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|