C12H14ClNO2S2 — CID 100701769
(3R)-N-[(3-chlorothiophen-2-yl)methyl]-1,1-dioxo-N-prop-2-ynylthiolan-3-amine (PubChem CID 100701769) has the molecular formula C12H14ClNO2S2 and a molecular weight of 303.84 g/mol. Its IUPAC name is (3R)-N-[(3-chlorothiophen-2-yl)methyl]-1,1-dioxo-N-prop-2-ynylthiolan-3-amine.
| Compound Name | (3R)-N-[(3-chlorothiophen-2-yl)methyl]-1,1-dioxo-N-prop-2-ynylthiolan-3-amine |
|---|---|
| PubChem CID | 100701769 |
| Molecular Formula | C12H14ClNO2S2 |
| Molecular Weight | 303.84 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | (3R)-N-[(3-chlorothiophen-2-yl)methyl]-1,1-dioxo-N-prop-2-ynylthiolan-3-amine |
| SMILES | C#CCN(Cc1sccc1Cl)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H14ClNO2S2/c1-2-5-14(8-12-11(13)3-6-17-12)10-4-7-18(15,16)9-10/h1,3,6,10H,4-5,7-9H2/t10-/m1/s1 |
| InChIKey | IMAREBLJJFYUIE-SNVBAGLBSA-N |
| XLogP | 2.02 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.84 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|