C21H26ClN3O3S2 — CID 98161545
(3S)-N-[[2-(3-chlorophenyl)imino-3-(3-methoxypropyl)-1,3-thiazol-4-yl]methyl]-1,1-dioxo-N-prop-2-ynylthiolan-3-amine (PubChem CID 98161545) has the molecular formula C21H26ClN3O3S2 and a molecular weight of 468.04 g/mol. Its IUPAC name is (3S)-N-[[2-(3-chlorophenyl)imino-3-(3-methoxypropyl)-1,3-thiazol-4-yl]methyl]-1,1-dioxo-N-prop-2-ynylthiolan-3-amine.
| Compound Name | (3S)-N-[[2-(3-chlorophenyl)imino-3-(3-methoxypropyl)-1,3-thiazol-4-yl]methyl]-1,1-dioxo-N-prop-2-ynylthiolan-3-amine |
|---|---|
| PubChem CID | 98161545 |
| Molecular Formula | C21H26ClN3O3S2 |
| Molecular Weight | 468.04 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | (3S)-N-[[2-(3-chlorophenyl)imino-3-(3-methoxypropyl)-1,3-thiazol-4-yl]methyl]-1,1-dioxo-N-prop-2-ynylthiolan-3-amine |
| SMILES | C#CCN(Cc1cs/c(=N\c2cccc(Cl)c2)n1CCCOC)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H26ClN3O3S2/c1-3-9-24(19-8-12-30(26,27)16-19)14-20-15-29-21(25(20)10-5-11-28-2)23-18-7-4-6-17(22)13-18/h1,4,6-7,13,15,19H,5,8-12,14,16H2,2H3/b23-21-/t19-/m0/s1 |
| InChIKey | XVHVHAMVYMXAMI-XHEFNCKESA-N |
| XLogP | 3.09 |
| TPSA | 63.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.04 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|