C13H19ClN2O3S — CID 95173139
(3S)-N-[(2-chloro-4-pyridinyl)methyl]-N-(2-methoxyethyl)-1,1-dioxothiolan-3-amine (PubChem CID 95173139) has the molecular formula C13H19ClN2O3S and a molecular weight of 318.83 g/mol. Its IUPAC name is (3S)-N-[(2-chloro-4-pyridinyl)methyl]-N-(2-methoxyethyl)-1,1-dioxothiolan-3-amine.
| Compound Name | (3S)-N-[(2-chloro-4-pyridinyl)methyl]-N-(2-methoxyethyl)-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 95173139 |
| Molecular Formula | C13H19ClN2O3S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | (3S)-N-[(2-chloro-4-pyridinyl)methyl]-N-(2-methoxyethyl)-1,1-dioxothiolan-3-amine |
| SMILES | COCCN(Cc1ccnc(Cl)c1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H19ClN2O3S/c1-19-6-5-16(12-3-7-20(17,18)10-12)9-11-2-4-15-13(14)8-11/h2,4,8,12H,3,5-7,9-10H2,1H3/t12-/m0/s1 |
| InChIKey | UZAVMLJWQGVAKQ-LBPRGKRZSA-N |
| XLogP | 1.37 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|