C16H27N3O5S — CID 9281374
3-[[[(3R)-1,1-dioxothiolan-3-yl]-(2-methoxyethyl)amino]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 9281374) has the molecular formula C16H27N3O5S and a molecular weight of 373.48 g/mol. Its IUPAC name is 3-[[[(3R)-1,1-dioxothiolan-3-yl]-(2-methoxyethyl)amino]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[[[(3R)-1,1-dioxothiolan-3-yl]-(2-methoxyethyl)amino]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 9281374 |
| Molecular Formula | C16H27N3O5S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 3-[[[(3R)-1,1-dioxothiolan-3-yl]-(2-methoxyethyl)amino]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | COCCN(CN1C(=O)NC2(CCCCC2)C1=O)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H27N3O5S/c1-24-9-8-18(13-5-10-25(22,23)11-13)12-19-14(20)16(17-15(19)21)6-3-2-4-7-16/h13H,2-12H2,1H3,(H,17,21)/t13-/m1/s1 |
| InChIKey | YNJJZDFMLLCVGU-CYBMUJFWSA-N |
| XLogP | 0.33 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|