C25H31N3O4S — CID 42933840
5,5-dibenzyl-3-[[(1,1-dioxothiolan-3-yl)-propylamino]methyl]imidazolidine-2,4-dione (PubChem CID 42933840) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is 5,5-dibenzyl-3-[[(1,1-dioxothiolan-3-yl)-propylamino]methyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dibenzyl-3-[[(1,1-dioxothiolan-3-yl)-propylamino]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42933840 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 5,5-dibenzyl-3-[[(1,1-dioxothiolan-3-yl)-propylamino]methyl]imidazolidine-2,4-dione |
| SMILES | CCCN(CN1C(=O)NC(Cc2ccccc2)(Cc2ccccc2)C1=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C25H31N3O4S/c1-2-14-27(22-13-15-33(31,32)18-22)19-28-23(29)25(26-24(28)30,16-20-9-5-3-6-10-20)17-21-11-7-4-8-12-21/h3-12,22H,2,13-19H2,1H3,(H,26,30) |
| InChIKey | YOWASORZFWMCOX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|