C17H30N3O5S+ — CID 9281335
(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)methyl-[(3R)-1,1-dioxothiolan-3-yl]-(2-methoxyethyl)azanium (PubChem CID 9281335) has the molecular formula C17H30N3O5S+ and a molecular weight of 388.51 g/mol. Its IUPAC name is (2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)methyl-[(3R)-1,1-dioxothiolan-3-yl]-(2-methoxyethyl)azanium.
| Compound Name | (2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)methyl-[(3R)-1,1-dioxothiolan-3-yl]-(2-methoxyethyl)azanium |
|---|---|
| PubChem CID | 9281335 |
| Molecular Formula | C17H30N3O5S+ |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | (2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)methyl-[(3R)-1,1-dioxothiolan-3-yl]-(2-methoxyethyl)azanium |
| SMILES | COCC[NH+](CN1C(=O)NC2(CCCCCC2)C1=O)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H29N3O5S/c1-25-10-9-19(14-6-11-26(23,24)12-14)13-20-15(21)17(18-16(20)22)7-4-2-3-5-8-17/h14H,2-13H2,1H3,(H,18,22)/p+1/t14-/m1/s1 |
| InChIKey | JZRPJNPJXOLRLO-CQSZACIVSA-O |
| XLogP | -0.69 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|