About 1-[[[(3S)-1,1-dioxothiolan-3-yl]-(2-methoxyethyl)amino]methyl]benzo[cd]indol-2-one
1-[[[(3S)-1,1-dioxothiolan-3-yl]-(2-methoxyethyl)amino]methyl]benzo[cd]indol-2-one (PubChem CID 9281272) has the molecular formula C19H22N2O4S
and a molecular weight of 374.46 g/mol. Its IUPAC name is 1-[[[(3S)-1,1-dioxothiolan-3-yl]-(2-methoxyethyl)amino]methyl]benzo[cd]indol-2-one.
Molecular Properties
| Compound Name | 1-[[[(3S)-1,1-dioxothiolan-3-yl]-(2-methoxyethyl)amino]methyl]benzo[cd]indol-2-one |
| PubChem CID | 9281272 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 1-[[[(3S)-1,1-dioxothiolan-3-yl]-(2-methoxyethyl)amino]methyl]benzo[cd]indol-2-one |
| SMILES | COCCN(CN1C(=O)c2cccc3cccc1c23)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H22N2O4S/c1-25-10-9-20(15-8-11-26(23,24)12-15)13-21-17-7-3-5-14-4-2-6-16(18(14)17)19(21)22/h2-7,15H,8-13H2,1H3/t15-/m0/s1 |
| InChIKey | DLVWVFDUGUSMRR-HNNXBMFYSA-N |
| XLogP | 1.89 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[[[(3S)-1,1-dioxothiolan-3-yl]-(2-methoxyethyl)amino]methyl]benzo[cd]indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[[(3S)-1,1-dioxothiolan-3-yl]-(2-methoxyethyl)amino]methyl]benzo[cd]indol-2-one?
The IUPAC name of 1-[[[(3S)-1,1-dioxothiolan-3-yl]-(2-methoxyethyl)amino]methyl]benzo[cd]indol-2-one (CID 9281272) is 1-[[[(3S)-1,1-dioxothiolan-3-yl]-(2-methoxyethyl)amino]methyl]benzo[cd]indol-2-one.
What is the SMILES notation for 1-[[[(3S)-1,1-dioxothiolan-3-yl]-(2-methoxyethyl)amino]methyl]benzo[cd]indol-2-one?
The canonical SMILES for 1-[[[(3S)-1,1-dioxothiolan-3-yl]-(2-methoxyethyl)amino]methyl]benzo[cd]indol-2-one is COCCN(CN1C(=O)c2cccc3cccc1c23)[C@H]1CCS(=O)(=O)C1.
What is the InChIKey of 1-[[[(3S)-1,1-dioxothiolan-3-yl]-(2-methoxyethyl)amino]methyl]benzo[cd]indol-2-one?
The InChIKey is DLVWVFDUGUSMRR-HNNXBMFYSA-N. The full InChI is InChI=1S/C19H22N2O4S/c1-25-10-9-20(15-8-11-26(23,24)12-15)13-21-17-7-3-5-14-4-2-6-16(18(14)17)19(21)22/h2-7,15H,8-13H2,1H3/t15-/m0/s1.
What are the key properties of 1-[[[(3S)-1,1-dioxothiolan-3-yl]-(2-methoxyethyl)amino]methyl]benzo[cd]indol-2-one?
1-[[[(3S)-1,1-dioxothiolan-3-yl]-(2-methoxyethyl)amino]methyl]benzo[cd]indol-2-one has a molecular weight of 374.46 g/mol, XLogP of 1.89, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[[(3S)-1,1-dioxothiolan-3-yl]-(2-methoxyethyl)amino]methyl]benzo[cd]indol-2-one is sourced from PubChem (CID 9281272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).