C17H21BrN2O4S — CID 18275962
4-bromo-1-[[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]methyl]indole-2,3-dione (PubChem CID 18275962) has the molecular formula C17H21BrN2O4S and a molecular weight of 429.34 g/mol. Its IUPAC name is 4-bromo-1-[[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]methyl]indole-2,3-dione.
| Compound Name | 4-bromo-1-[[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 18275962 |
| Molecular Formula | C17H21BrN2O4S |
| Molecular Weight | 429.34 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | 4-bromo-1-[[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]methyl]indole-2,3-dione |
| SMILES | CC(C)CN(CN1C(=O)C(=O)c2c(Br)cccc21)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H21BrN2O4S/c1-11(2)8-19(12-6-7-25(23,24)9-12)10-20-14-5-3-4-13(18)15(14)16(21)17(20)22/h3-5,11-12H,6-10H2,1-2H3 |
| InChIKey | BYPRLVVDZYDYPA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|