C20H29N3O2S2 — CID 24605501
1-(3,5-dimethylphenyl)-3-[[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]methyl]imidazole-2-thione (PubChem CID 24605501) has the molecular formula C20H29N3O2S2 and a molecular weight of 407.61 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]methyl]imidazole-2-thione.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]methyl]imidazole-2-thione |
|---|---|
| PubChem CID | 24605501 |
| Molecular Formula | C20H29N3O2S2 |
| Molecular Weight | 407.61 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]methyl]imidazole-2-thione |
| SMILES | Cc1cc(C)cc(-n2ccn(CN(CC(C)C)C3CCS(=O)(=O)C3)c2=S)c1 |
| InChI | InChI=1S/C20H29N3O2S2/c1-15(2)12-22(18-5-8-27(24,25)13-18)14-21-6-7-23(20(21)26)19-10-16(3)9-17(4)11-19/h6-7,9-11,15,18H,5,8,12-14H2,1-4H3 |
| InChIKey | GKXMTNQDLWIBDP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 47.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.61 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|