C17H27NO3S — CID 24605390
2-[[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]methyl]-4,5-dimethylphenol (PubChem CID 24605390) has the molecular formula C17H27NO3S and a molecular weight of 325.47 g/mol. Its IUPAC name is 2-[[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]methyl]-4,5-dimethylphenol.
| Compound Name | 2-[[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]methyl]-4,5-dimethylphenol |
|---|---|
| PubChem CID | 24605390 |
| Molecular Formula | C17H27NO3S |
| Molecular Weight | 325.47 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 2-[[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]methyl]-4,5-dimethylphenol |
| SMILES | Cc1cc(O)c(CN(CC(C)C)C2CCS(=O)(=O)C2)cc1C |
| InChI | InChI=1S/C17H27NO3S/c1-12(2)9-18(16-5-6-22(20,21)11-16)10-15-7-13(3)14(4)8-17(15)19/h7-8,12,16,19H,5-6,9-11H2,1-4H3 |
| InChIKey | LXPPLHNQLRVTNP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|