C17H28NO3S+ — CID 9242140
[(3S)-1,1-dioxothiolan-3-yl]-ethyl-[(2-hydroxy-4-methyl-5-propan-2-ylphenyl)methyl]azanium (PubChem CID 9242140) has the molecular formula C17H28NO3S+ and a molecular weight of 326.48 g/mol. Its IUPAC name is [(3S)-1,1-dioxothiolan-3-yl]-ethyl-[(2-hydroxy-4-methyl-5-propan-2-ylphenyl)methyl]azanium.
| Compound Name | [(3S)-1,1-dioxothiolan-3-yl]-ethyl-[(2-hydroxy-4-methyl-5-propan-2-ylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 9242140 |
| Molecular Formula | C17H28NO3S+ |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | [(3S)-1,1-dioxothiolan-3-yl]-ethyl-[(2-hydroxy-4-methyl-5-propan-2-ylphenyl)methyl]azanium |
| SMILES | CC[NH+](Cc1cc(C(C)C)c(C)cc1O)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H27NO3S/c1-5-18(15-6-7-22(20,21)11-15)10-14-9-16(12(2)3)13(4)8-17(14)19/h8-9,12,15,19H,5-7,10-11H2,1-4H3/p+1/t15-/m0/s1 |
| InChIKey | ALNFSNIFZVZQIQ-HNNXBMFYSA-O |
| XLogP | 1.42 |
| TPSA | 58.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|