C20H28NO6S+ — CID 9281496
[(3R)-1,1-dioxothiolan-3-yl]-[(6-ethyl-7-hydroxy-4-methyl-2-oxochromen-8-yl)methyl]-(2-methoxyethyl)azanium (PubChem CID 9281496) has the molecular formula C20H28NO6S+ and a molecular weight of 410.51 g/mol. Its IUPAC name is [(3R)-1,1-dioxothiolan-3-yl]-[(6-ethyl-7-hydroxy-4-methyl-2-oxochromen-8-yl)methyl]-(2-methoxyethyl)azanium.
| Compound Name | [(3R)-1,1-dioxothiolan-3-yl]-[(6-ethyl-7-hydroxy-4-methyl-2-oxochromen-8-yl)methyl]-(2-methoxyethyl)azanium |
|---|---|
| PubChem CID | 9281496 |
| Molecular Formula | C20H28NO6S+ |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | [(3R)-1,1-dioxothiolan-3-yl]-[(6-ethyl-7-hydroxy-4-methyl-2-oxochromen-8-yl)methyl]-(2-methoxyethyl)azanium |
| SMILES | CCc1cc2c(C)cc(=O)oc2c(C[NH+](CCOC)[C@@H]2CCS(=O)(=O)C2)c1O |
| InChI | InChI=1S/C20H27NO6S/c1-4-14-10-16-13(2)9-18(22)27-20(16)17(19(14)23)11-21(6-7-26-3)15-5-8-28(24,25)12-15/h9-10,15,23H,4-8,11-12H2,1-3H3/p+1/t15-/m1/s1 |
| InChIKey | HCCLZXHGFBJPAD-OAHLLOKOSA-O |
| XLogP | 0.59 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|