C22H32ClNO3 — CID 24835317
8-[[cyclohexyl(ethyl)amino]methyl]-7-hydroxy-4-methyl-6-propylchromen-2-one;hydrochloride (PubChem CID 24835317) has the molecular formula C22H32ClNO3 and a molecular weight of 393.96 g/mol. Its IUPAC name is 8-[[cyclohexyl(ethyl)amino]methyl]-7-hydroxy-4-methyl-6-propylchromen-2-one;hydrochloride.
| Compound Name | 8-[[cyclohexyl(ethyl)amino]methyl]-7-hydroxy-4-methyl-6-propylchromen-2-one;hydrochloride |
|---|---|
| PubChem CID | 24835317 |
| Molecular Formula | C22H32ClNO3 |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 8-[[cyclohexyl(ethyl)amino]methyl]-7-hydroxy-4-methyl-6-propylchromen-2-one;hydrochloride |
| SMILES | CCCc1cc2c(C)cc(=O)oc2c(CN(CC)C2CCCCC2)c1O.Cl |
| InChI | InChI=1S/C22H31NO3.ClH/c1-4-9-16-13-18-15(3)12-20(24)26-22(18)19(21(16)25)14-23(5-2)17-10-7-6-8-11-17;/h12-13,17,25H,4-11,14H2,1-3H3;1H |
| InChIKey | SZYZUZMMAGYLIU-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|