C18H23ClNO3+ — CID 7461185
6-chloro-7-hydroxy-8-(piperidin-1-ium-1-ylmethyl)-4-propylchromen-2-one (PubChem CID 7461185) has the molecular formula C18H23ClNO3+ and a molecular weight of 336.84 g/mol. Its IUPAC name is 6-chloro-7-hydroxy-8-(piperidin-1-ium-1-ylmethyl)-4-propylchromen-2-one.
| Compound Name | 6-chloro-7-hydroxy-8-(piperidin-1-ium-1-ylmethyl)-4-propylchromen-2-one |
|---|---|
| PubChem CID | 7461185 |
| Molecular Formula | C18H23ClNO3+ |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 6-chloro-7-hydroxy-8-(piperidin-1-ium-1-ylmethyl)-4-propylchromen-2-one |
| SMILES | CCCc1cc(=O)oc2c(C[NH+]3CCCCC3)c(O)c(Cl)cc12 |
| InChI | InChI=1S/C18H22ClNO3/c1-2-6-12-9-16(21)23-18-13(12)10-15(19)17(22)14(18)11-20-7-4-3-5-8-20/h9-10,22H,2-8,11H2,1H3/p+1 |
| InChIKey | HODUTTCWKJIMSS-UHFFFAOYSA-O |
| XLogP | 2.67 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|