C18H25ClN2O3+2 — CID 7499532
6-chloro-7-hydroxy-8-[(4-methylpiperazine-1,4-diium-1-yl)methyl]-4-propylchromen-2-one (PubChem CID 7499532) has the molecular formula C18H25ClN2O3+2 and a molecular weight of 352.86 g/mol. Its IUPAC name is 6-chloro-7-hydroxy-8-[(4-methylpiperazine-1,4-diium-1-yl)methyl]-4-propylchromen-2-one.
| Compound Name | 6-chloro-7-hydroxy-8-[(4-methylpiperazine-1,4-diium-1-yl)methyl]-4-propylchromen-2-one |
|---|---|
| PubChem CID | 7499532 |
| Molecular Formula | C18H25ClN2O3+2 |
| Molecular Weight | 352.86 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 6-chloro-7-hydroxy-8-[(4-methylpiperazine-1,4-diium-1-yl)methyl]-4-propylchromen-2-one |
| SMILES | CCCc1cc(=O)oc2c(C[NH+]3CC[NH+](C)CC3)c(O)c(Cl)cc12 |
| InChI | InChI=1S/C18H23ClN2O3/c1-3-4-12-9-16(22)24-18-13(12)10-15(19)17(23)14(18)11-21-7-5-20(2)6-8-21/h9-10,23H,3-8,11H2,1-2H3/p+2 |
| InChIKey | SFHKWMHJVSCOSC-UHFFFAOYSA-P |
| XLogP | 0.02 |
| TPSA | 59.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.86 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|