C22H25ClNO4+ — CID 7692442
(6-chloro-7-hydroxy-2-oxo-4-propylchromen-8-yl)methyl-[2-(2-methoxyphenyl)ethyl]azanium (PubChem CID 7692442) has the molecular formula C22H25ClNO4+ and a molecular weight of 402.90 g/mol. Its IUPAC name is (6-chloro-7-hydroxy-2-oxo-4-propylchromen-8-yl)methyl-[2-(2-methoxyphenyl)ethyl]azanium.
| Compound Name | (6-chloro-7-hydroxy-2-oxo-4-propylchromen-8-yl)methyl-[2-(2-methoxyphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 7692442 |
| Molecular Formula | C22H25ClNO4+ |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | (6-chloro-7-hydroxy-2-oxo-4-propylchromen-8-yl)methyl-[2-(2-methoxyphenyl)ethyl]azanium |
| SMILES | CCCc1cc(=O)oc2c(C[NH2+]CCc3ccccc3OC)c(O)c(Cl)cc12 |
| InChI | InChI=1S/C22H24ClNO4/c1-3-6-15-11-20(25)28-22-16(15)12-18(23)21(26)17(22)13-24-10-9-14-7-4-5-8-19(14)27-2/h4-5,7-8,11-12,24,26H,3,6,9-10,13H2,1-2H3/p+1 |
| InChIKey | HEWOGVJNMBDJAW-UHFFFAOYSA-O |
| XLogP | 3.42 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|