C8H14NO6S+ — CID 18801477
bis(carboxymethyl)-(1,1-dioxothiolan-3-yl)azanium (PubChem CID 18801477) has the molecular formula C8H14NO6S+ and a molecular weight of 252.27 g/mol. Its IUPAC name is bis(carboxymethyl)-(1,1-dioxothiolan-3-yl)azanium.
| Compound Name | bis(carboxymethyl)-(1,1-dioxothiolan-3-yl)azanium |
|---|---|
| PubChem CID | 18801477 |
| Molecular Formula | C8H14NO6S+ |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | bis(carboxymethyl)-(1,1-dioxothiolan-3-yl)azanium |
| SMILES | O=C(O)C[NH+](CC(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H13NO6S/c10-7(11)3-9(4-8(12)13)6-1-2-16(14,15)5-6/h6H,1-5H2,(H,10,11)(H,12,13)/p+1 |
| InChIKey | BGCWFHXVBVYRBV-UHFFFAOYSA-O |
| XLogP | -2.77 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |