4-hydroxy-1,1-dioxothiane-3-carboxylic acid

C6H10O5S — CID 82401360

IUPAC4-hydroxy-1,1-dioxothiane-3-carboxylic acid
SMILESO=C(O)C1CS(=O)(=O)CCC1O
InChIInChI=1S/C6H10O5S/c7-5-1-2-12(10,11)3-4(5)6(8)9/h4-5,7H,1-3H2,(H,8,9)
InChIKeyPYKSKTFZYCNRNZ-UHFFFAOYSA-N
MW194.21 g/mol
LogP-1.13
Rot. Bonds1

About 4-hydroxy-1,1-dioxothiane-3-carboxylic acid

4-hydroxy-1,1-dioxothiane-3-carboxylic acid (PubChem CID 82401360) has the molecular formula C6H10O5S and a molecular weight of 194.21 g/mol. Its IUPAC name is 4-hydroxy-1,1-dioxothiane-3-carboxylic acid.

Molecular Properties

Compound Name4-hydroxy-1,1-dioxothiane-3-carboxylic acid
PubChem CID82401360
Molecular FormulaC6H10O5S
Molecular Weight194.21 g/mol
Exact Mass194.02
IUPAC Name4-hydroxy-1,1-dioxothiane-3-carboxylic acid
SMILESO=C(O)C1CS(=O)(=O)CCC1O
InChIInChI=1S/C6H10O5S/c7-5-1-2-12(10,11)3-4(5)6(8)9/h4-5,7H,1-3H2,(H,8,9)
InChIKeyPYKSKTFZYCNRNZ-UHFFFAOYSA-N
XLogP-1.13
TPSA91.67 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.21
LogP ≤ 5-1.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-hydroxy-1,1-dioxothiane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-hydroxy-1,1-dioxothiane-3-carboxylic acid?
The IUPAC name of 4-hydroxy-1,1-dioxothiane-3-carboxylic acid (CID 82401360) is 4-hydroxy-1,1-dioxothiane-3-carboxylic acid.
What is the SMILES notation for 4-hydroxy-1,1-dioxothiane-3-carboxylic acid?
The canonical SMILES for 4-hydroxy-1,1-dioxothiane-3-carboxylic acid is O=C(O)C1CS(=O)(=O)CCC1O.
What is the InChIKey of 4-hydroxy-1,1-dioxothiane-3-carboxylic acid?
The InChIKey is PYKSKTFZYCNRNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O5S/c7-5-1-2-12(10,11)3-4(5)6(8)9/h4-5,7H,1-3H2,(H,8,9).
What are the key properties of 4-hydroxy-1,1-dioxothiane-3-carboxylic acid?
4-hydroxy-1,1-dioxothiane-3-carboxylic acid has a molecular weight of 194.21 g/mol, XLogP of -1.13, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-1,1-dioxothiane-3-carboxylic acid is sourced from PubChem (CID 82401360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).