C15H20ClNO4S — CID 136550072
2-chloro-4-[[(1,1-dioxothiolan-3-yl)-propylamino]methyl]benzoic acid (PubChem CID 136550072) has the molecular formula C15H20ClNO4S and a molecular weight of 345.85 g/mol. Its IUPAC name is 2-chloro-4-[[(1,1-dioxothiolan-3-yl)-propylamino]methyl]benzoic acid.
| Compound Name | 2-chloro-4-[[(1,1-dioxothiolan-3-yl)-propylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 136550072 |
| Molecular Formula | C15H20ClNO4S |
| Molecular Weight | 345.85 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 2-chloro-4-[[(1,1-dioxothiolan-3-yl)-propylamino]methyl]benzoic acid |
| SMILES | CCCN(Cc1ccc(C(=O)O)c(Cl)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H20ClNO4S/c1-2-6-17(12-5-7-22(20,21)10-12)9-11-3-4-13(15(18)19)14(16)8-11/h3-4,8,12H,2,5-7,9-10H2,1H3,(H,18,19) |
| InChIKey | PKDKHYOGSSMZFC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.85 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |