C16H25NO2S — CID 129437128
(3S)-N-[[(1S,6R)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-1,1-dioxo-N-prop-2-ynylthiolan-3-amine (PubChem CID 129437128) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is (3S)-N-[[(1S,6R)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-1,1-dioxo-N-prop-2-ynylthiolan-3-amine.
| Compound Name | (3S)-N-[[(1S,6R)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-1,1-dioxo-N-prop-2-ynylthiolan-3-amine |
|---|---|
| PubChem CID | 129437128 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | (3S)-N-[[(1S,6R)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-1,1-dioxo-N-prop-2-ynylthiolan-3-amine |
| SMILES | C#CCN(C[C@@H]1C(C)=CCC[C@H]1C)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H25NO2S/c1-4-9-17(15-8-10-20(18,19)12-15)11-16-13(2)6-5-7-14(16)3/h1,6,14-16H,5,7-12H2,2-3H3/t14-,15+,16-/m1/s1 |
| InChIKey | WBFLXOZZMDNYRP-OWCLPIDISA-N |
| XLogP | 2.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|