C13H23NO3S — CID 124851494
(3S)-N-[2-(2-methylpropoxy)ethyl]-1,1-dioxo-N-prop-2-ynylthiolan-3-amine (PubChem CID 124851494) has the molecular formula C13H23NO3S and a molecular weight of 273.40 g/mol. Its IUPAC name is (3S)-N-[2-(2-methylpropoxy)ethyl]-1,1-dioxo-N-prop-2-ynylthiolan-3-amine.
| Compound Name | (3S)-N-[2-(2-methylpropoxy)ethyl]-1,1-dioxo-N-prop-2-ynylthiolan-3-amine |
|---|---|
| PubChem CID | 124851494 |
| Molecular Formula | C13H23NO3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | (3S)-N-[2-(2-methylpropoxy)ethyl]-1,1-dioxo-N-prop-2-ynylthiolan-3-amine |
| SMILES | C#CCN(CCOCC(C)C)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H23NO3S/c1-4-6-14(7-8-17-10-12(2)3)13-5-9-18(15,16)11-13/h1,12-13H,5-11H2,2-3H3/t13-/m0/s1 |
| InChIKey | SLHBQDPTQJBONU-ZDUSSCGKSA-N |
| XLogP | 0.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|