C23H26N2O3S — CID 56541083
2-[(1,1-dioxothiolan-3-yl)-prop-2-ynylamino]-N-(1,2-diphenylethyl)acetamide (PubChem CID 56541083) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-prop-2-ynylamino]-N-(1,2-diphenylethyl)acetamide.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)-prop-2-ynylamino]-N-(1,2-diphenylethyl)acetamide |
|---|---|
| PubChem CID | 56541083 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)-prop-2-ynylamino]-N-(1,2-diphenylethyl)acetamide |
| SMILES | C#CCN(CC(=O)NC(Cc1ccccc1)c1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C23H26N2O3S/c1-2-14-25(21-13-15-29(27,28)18-21)17-23(26)24-22(20-11-7-4-8-12-20)16-19-9-5-3-6-10-19/h1,3-12,21-22H,13-18H2,(H,24,26) |
| InChIKey | UGBNCLFKOAEXNF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|