C21H24N4O5S — CID 56574804
6-amino-1-benzyl-5-[2-[(1,1-dioxothiolan-3-yl)-prop-2-ynylamino]acetyl]-3-methylpyrimidine-2,4-dione (PubChem CID 56574804) has the molecular formula C21H24N4O5S and a molecular weight of 444.51 g/mol. Its IUPAC name is 6-amino-1-benzyl-5-[2-[(1,1-dioxothiolan-3-yl)-prop-2-ynylamino]acetyl]-3-methylpyrimidine-2,4-dione.
| Compound Name | 6-amino-1-benzyl-5-[2-[(1,1-dioxothiolan-3-yl)-prop-2-ynylamino]acetyl]-3-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 56574804 |
| Molecular Formula | C21H24N4O5S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 6-amino-1-benzyl-5-[2-[(1,1-dioxothiolan-3-yl)-prop-2-ynylamino]acetyl]-3-methylpyrimidine-2,4-dione |
| SMILES | C#CCN(CC(=O)c1c(N)n(Cc2ccccc2)c(=O)n(C)c1=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H24N4O5S/c1-3-10-24(16-9-11-31(29,30)14-16)13-17(26)18-19(22)25(21(28)23(2)20(18)27)12-15-7-5-4-6-8-15/h1,4-8,16H,9-14,22H2,2H3 |
| InChIKey | ZNHCQCROQUTFAG-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 124.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|