C22H28N2O3S — CID 95786005
2-[(1,1-dioxothian-4-yl)-methylamino]-N-[(1R)-1,2-diphenylethyl]acetamide (PubChem CID 95786005) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is 2-[(1,1-dioxothian-4-yl)-methylamino]-N-[(1R)-1,2-diphenylethyl]acetamide.
| Compound Name | 2-[(1,1-dioxothian-4-yl)-methylamino]-N-[(1R)-1,2-diphenylethyl]acetamide |
|---|---|
| PubChem CID | 95786005 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 2-[(1,1-dioxothian-4-yl)-methylamino]-N-[(1R)-1,2-diphenylethyl]acetamide |
| SMILES | CN(CC(=O)N[C@H](Cc1ccccc1)c1ccccc1)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C22H28N2O3S/c1-24(20-12-14-28(26,27)15-13-20)17-22(25)23-21(19-10-6-3-7-11-19)16-18-8-4-2-5-9-18/h2-11,20-21H,12-17H2,1H3,(H,23,25)/t21-/m1/s1 |
| InChIKey | BJHKUTASXFAQFD-OAQYLSRUSA-N |
| XLogP | 2.60 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |