C17H26N2O3S2 — CID 8683130
1-[(3R)-1,1-dioxothiolan-3-yl]-3-(4-ethoxyphenyl)-1-(2-methylpropyl)thiourea (PubChem CID 8683130) has the molecular formula C17H26N2O3S2 and a molecular weight of 370.54 g/mol. Its IUPAC name is 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(4-ethoxyphenyl)-1-(2-methylpropyl)thiourea.
| Compound Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(4-ethoxyphenyl)-1-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 8683130 |
| Molecular Formula | C17H26N2O3S2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(4-ethoxyphenyl)-1-(2-methylpropyl)thiourea |
| SMILES | CCOc1ccc(NC(=S)N(CC(C)C)[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C17H26N2O3S2/c1-4-22-16-7-5-14(6-8-16)18-17(23)19(11-13(2)3)15-9-10-24(20,21)12-15/h5-8,13,15H,4,9-12H2,1-3H3,(H,18,23)/t15-/m1/s1 |
| InChIKey | HKWOMWGZRLDKMU-OAHLLOKOSA-N |
| XLogP | 2.93 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|