C18H22N2O4S2 — CID 8683014
1-[(3R)-1,1-dioxothiolan-3-yl]-3-(4-ethoxyphenyl)-1-(furan-2-ylmethyl)thiourea (PubChem CID 8683014) has the molecular formula C18H22N2O4S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(4-ethoxyphenyl)-1-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(4-ethoxyphenyl)-1-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 8683014 |
| Molecular Formula | C18H22N2O4S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(4-ethoxyphenyl)-1-(furan-2-ylmethyl)thiourea |
| SMILES | CCOc1ccc(NC(=S)N(Cc2ccco2)[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C18H22N2O4S2/c1-2-23-16-7-5-14(6-8-16)19-18(25)20(12-17-4-3-10-24-17)15-9-11-26(21,22)13-15/h3-8,10,15H,2,9,11-13H2,1H3,(H,19,25)/t15-/m1/s1 |
| InChIKey | NUAXDAJDVGOSGC-OAHLLOKOSA-N |
| XLogP | 3.06 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|