C18H13N3O3S2 — CID 122286500
N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]-1,2-oxazole-4-sulfonamide (PubChem CID 122286500) has the molecular formula C18H13N3O3S2 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]-1,2-oxazole-4-sulfonamide.
| Compound Name | N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 122286500 |
| Molecular Formula | C18H13N3O3S2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]-1,2-oxazole-4-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(-c2csc(-c3ccccc3)n2)cc1)c1cnoc1 |
| InChI | InChI=1S/C18H13N3O3S2/c22-26(23,16-10-19-24-11-16)21-15-8-6-13(7-9-15)17-12-25-18(20-17)14-4-2-1-3-5-14/h1-12,21H |
| InChIKey | VGYVBVNKJQIWMJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |