C22H16N4O6S2 — CID 46497692
4-methyl-3,5-dinitro-N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]benzenesulfonamide (PubChem CID 46497692) has the molecular formula C22H16N4O6S2 and a molecular weight of 496.53 g/mol. Its IUPAC name is 4-methyl-3,5-dinitro-N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-methyl-3,5-dinitro-N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46497692 |
| Molecular Formula | C22H16N4O6S2 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | 4-methyl-3,5-dinitro-N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]benzenesulfonamide |
| SMILES | Cc1c([N+](=O)[O-])cc(S(=O)(=O)Nc2cccc(-c3csc(-c4ccccc4)n3)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H16N4O6S2/c1-14-20(25(27)28)11-18(12-21(14)26(29)30)34(31,32)24-17-9-5-8-16(10-17)19-13-33-22(23-19)15-6-3-2-4-7-15/h2-13,24H,1H3 |
| InChIKey | GGTIBKQEUANYHL-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 145.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|