C21H21N5O7S — CID 43985816
4-methyl-N-[3-[6-(2-methylpropoxy)pyridazin-3-yl]phenyl]-3,5-dinitrobenzenesulfonamide (PubChem CID 43985816) has the molecular formula C21H21N5O7S and a molecular weight of 487.49 g/mol. Its IUPAC name is 4-methyl-N-[3-[6-(2-methylpropoxy)pyridazin-3-yl]phenyl]-3,5-dinitrobenzenesulfonamide.
| Compound Name | 4-methyl-N-[3-[6-(2-methylpropoxy)pyridazin-3-yl]phenyl]-3,5-dinitrobenzenesulfonamide |
|---|---|
| PubChem CID | 43985816 |
| Molecular Formula | C21H21N5O7S |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 4-methyl-N-[3-[6-(2-methylpropoxy)pyridazin-3-yl]phenyl]-3,5-dinitrobenzenesulfonamide |
| SMILES | Cc1c([N+](=O)[O-])cc(S(=O)(=O)Nc2cccc(-c3ccc(OCC(C)C)nn3)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H21N5O7S/c1-13(2)12-33-21-8-7-18(22-23-21)15-5-4-6-16(9-15)24-34(31,32)17-10-19(25(27)28)14(3)20(11-17)26(29)30/h4-11,13,24H,12H2,1-3H3 |
| InChIKey | OPWGWLQYQPOFIG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 167.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|