C18H16ClN5O4S — CID 24663047
3-chloro-N-[3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)phenyl]-4-methyl-5-nitrobenzenesulfonamide (PubChem CID 24663047) has the molecular formula C18H16ClN5O4S and a molecular weight of 433.88 g/mol. Its IUPAC name is 3-chloro-N-[3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)phenyl]-4-methyl-5-nitrobenzenesulfonamide.
| Compound Name | 3-chloro-N-[3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)phenyl]-4-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 24663047 |
| Molecular Formula | C18H16ClN5O4S |
| Molecular Weight | 433.88 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | 3-chloro-N-[3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)phenyl]-4-methyl-5-nitrobenzenesulfonamide |
| SMILES | Cc1c(Cl)cc(S(=O)(=O)Nc2cccc(-c3nnc4n3CCC4)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H16ClN5O4S/c1-11-15(19)9-14(10-16(11)24(25)26)29(27,28)22-13-5-2-4-12(8-13)18-21-20-17-6-3-7-23(17)18/h2,4-5,8-10,22H,3,6-7H2,1H3 |
| InChIKey | YYLDSNQYYGFWIJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.88 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|