C19H18Cl2N4O2S — CID 24663037
2,5-dichloro-N-[3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)phenyl]-3,6-dimethylbenzenesulfonamide (PubChem CID 24663037) has the molecular formula C19H18Cl2N4O2S and a molecular weight of 437.35 g/mol. Its IUPAC name is 2,5-dichloro-N-[3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)phenyl]-3,6-dimethylbenzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)phenyl]-3,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 24663037 |
| Molecular Formula | C19H18Cl2N4O2S |
| Molecular Weight | 437.35 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 2,5-dichloro-N-[3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)phenyl]-3,6-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(Cl)c(C)c(S(=O)(=O)Nc2cccc(-c3nnc4n3CCC4)c2)c1Cl |
| InChI | InChI=1S/C19H18Cl2N4O2S/c1-11-9-15(20)12(2)18(17(11)21)28(26,27)24-14-6-3-5-13(10-14)19-23-22-16-7-4-8-25(16)19/h3,5-6,9-10,24H,4,7-8H2,1-2H3 |
| InChIKey | KRGLFBIIIOYKGS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.35 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |