C24H22N2O4S — CID 10598953
N-[2-(4-tert-butylphenyl)-4-oxo-3,1-benzoxazin-6-yl]benzenesulfonamide (PubChem CID 10598953) has the molecular formula C24H22N2O4S and a molecular weight of 434.52 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenyl)-4-oxo-3,1-benzoxazin-6-yl]benzenesulfonamide.
| Compound Name | N-[2-(4-tert-butylphenyl)-4-oxo-3,1-benzoxazin-6-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 10598953 |
| Molecular Formula | C24H22N2O4S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | N-[2-(4-tert-butylphenyl)-4-oxo-3,1-benzoxazin-6-yl]benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(-c2nc3ccc(NS(=O)(=O)c4ccccc4)cc3c(=O)o2)cc1 |
| InChI | InChI=1S/C24H22N2O4S/c1-24(2,3)17-11-9-16(10-12-17)22-25-21-14-13-18(15-20(21)23(27)30-22)26-31(28,29)19-7-5-4-6-8-19/h4-15,26H,1-3H3 |
| InChIKey | KSFIJIURZUSTFE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |