C17H17ClN4O2 — CID 14162077
2-amino-N'-(6-chloro-2-methoxyacridin-9-yl)propanehydrazide (PubChem CID 14162077) has the molecular formula C17H17ClN4O2 and a molecular weight of 344.80 g/mol. Its IUPAC name is 2-amino-N'-(6-chloro-2-methoxyacridin-9-yl)propanehydrazide.
| Compound Name | 2-amino-N'-(6-chloro-2-methoxyacridin-9-yl)propanehydrazide |
|---|---|
| PubChem CID | 14162077 |
| Molecular Formula | C17H17ClN4O2 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 2-amino-N'-(6-chloro-2-methoxyacridin-9-yl)propanehydrazide |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(NNC(=O)C(C)N)c2c1 |
| InChI | InChI=1S/C17H17ClN4O2/c1-9(19)17(23)22-21-16-12-5-3-10(18)7-15(12)20-14-6-4-11(24-2)8-13(14)16/h3-9H,19H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | KBJNUKCLBQGFTH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|